C17H18F3N3O5 — CID 166457168
(5S,7R,8R,9S,10S)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol (PubChem CID 166457168) has the molecular formula C17H18F3N3O5 and a molecular weight of 401.34 g/mol. Its IUPAC name is (5S,7R,8R,9S,10S)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol.
| Compound Name | (5S,7R,8R,9S,10S)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol |
|---|---|
| PubChem CID | 166457168 |
| Molecular Formula | C17H18F3N3O5 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (5S,7R,8R,9S,10S)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decane-8,10-diol |
| SMILES | OC[C@H]1O[C@@]2(CCCO2)[C@@H](O)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C17H18F3N3O5/c18-9-4-8(5-10(19)13(9)20)11-6-23(22-21-11)14-15(25)12(7-24)28-17(16(14)26)2-1-3-27-17/h4-6,12,14-16,24-26H,1-3,7H2/t12-,14+,15+,16+,17+/m1/s1 |
| InChIKey | LCUOTJTWESTWEP-VFTHGPRRSA-N |
| XLogP | 0.52 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|