C19H20F5N3O5 — CID 166457176
(5S,7R,8R,9S,10R)-10-(2,2-difluoroethoxy)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol (PubChem CID 166457176) has the molecular formula C19H20F5N3O5 and a molecular weight of 465.38 g/mol. Its IUPAC name is (5S,7R,8R,9S,10R)-10-(2,2-difluoroethoxy)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol.
| Compound Name | (5S,7R,8R,9S,10R)-10-(2,2-difluoroethoxy)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 166457176 |
| Molecular Formula | C19H20F5N3O5 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (5S,7R,8R,9S,10R)-10-(2,2-difluoroethoxy)-7-(hydroxymethyl)-9-[4-(3,4,5-trifluorophenyl)triazol-1-yl]-1,6-dioxaspiro[4.5]decan-8-ol |
| SMILES | OC[C@H]1O[C@@]2(CCCO2)[C@H](OCC(F)F)[C@@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1O |
| InChI | InChI=1S/C19H20F5N3O5/c20-10-4-9(5-11(21)15(10)24)12-6-27(26-25-12)16-17(29)13(7-28)32-19(2-1-3-31-19)18(16)30-8-14(22)23/h4-6,13-14,16-18,28-29H,1-3,7-8H2/t13-,16+,17+,18-,19+/m1/s1 |
| InChIKey | RGULYPPIOLZBLB-DTBDJWGBSA-N |
| XLogP | 1.81 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|