C40H38F3N3O5 — CID 166457277
1-[(2S,3R,4S,5R,6R)-2-ethenyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 166457277) has the molecular formula C40H38F3N3O5 and a molecular weight of 697.75 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-2-ethenyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-2-ethenyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 166457277 |
| Molecular Formula | C40H38F3N3O5 |
| Molecular Weight | 697.75 g/mol |
| Exact Mass | 697.28 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-2-ethenyl-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | C=CCO[C@@]1(C=C)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C40H38F3N3O5/c1-3-20-50-40(4-2)39(49-26-30-18-12-7-13-19-30)37(46-23-34(44-45-46)31-21-32(41)36(43)33(42)22-31)38(48-25-29-16-10-6-11-17-29)35(51-40)27-47-24-28-14-8-5-9-15-28/h3-19,21-23,35,37-39H,1-2,20,24-27H2/t35-,37+,38+,39-,40+/m1/s1 |
| InChIKey | MOYRQYLLRUWRKB-KDSZZTFKSA-N |
| XLogP | 7.77 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|