C35H32F3N3O5 — CID 166457278
(3R,4S,5R,6R)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol (PubChem CID 166457278) has the molecular formula C35H32F3N3O5 and a molecular weight of 631.65 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol.
| Compound Name | (3R,4S,5R,6R)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol |
|---|---|
| PubChem CID | 166457278 |
| Molecular Formula | C35H32F3N3O5 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | (3R,4S,5R,6R)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-ol |
| SMILES | OC1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H32F3N3O5/c36-27-16-26(17-28(37)31(27)38)29-18-41(40-39-29)32-33(44-20-24-12-6-2-7-13-24)30(22-43-19-23-10-4-1-5-11-23)46-35(42)34(32)45-21-25-14-8-3-9-15-25/h1-18,30,32-35,42H,19-22H2/t30-,32+,33+,34-,35?/m1/s1 |
| InChIKey | DKDWVHUUGLYWHS-HNGBTHLLSA-N |
| XLogP | 6.01 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|