C39H36F3N3O5 — CID 166457285
1-[(2R,3R,4S,5R,6S)-3,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undec-9-en-4-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 166457285) has the molecular formula C39H36F3N3O5 and a molecular weight of 683.73 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R,6S)-3,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undec-9-en-4-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[(2R,3R,4S,5R,6S)-3,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undec-9-en-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 166457285 |
| Molecular Formula | C39H36F3N3O5 |
| Molecular Weight | 683.73 g/mol |
| Exact Mass | 683.26 |
| IUPAC Name | 1-[(2R,3R,4S,5R,6S)-3,5-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-1,7-dioxaspiro[5.5]undec-9-en-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | Fc1cc(-c2cn([C@H]3[C@@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O[C@@]4(CC=CCO4)[C@@H]3OCc3ccccc3)nn2)cc(F)c1F |
| InChI | InChI=1S/C39H36F3N3O5/c40-31-20-30(21-32(41)35(31)42)33-22-45(44-43-33)36-37(47-24-28-14-6-2-7-15-28)34(26-46-23-27-12-4-1-5-13-27)50-39(18-10-11-19-49-39)38(36)48-25-29-16-8-3-9-17-29/h1-17,20-22,34,36-38H,18-19,23-26H2/t34-,36+,37+,38-,39+/m1/s1 |
| InChIKey | NGWYRJCHMFYQBA-DEPSEAIFSA-N |
| XLogP | 7.36 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.73 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|