C41H40F3N3O5 — CID 166457334
1-[(2S,3R,4S,5R,6R)-2-ethenyl-2-(2-methylprop-2-enoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 166457334) has the molecular formula C41H40F3N3O5 and a molecular weight of 711.78 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5R,6R)-2-ethenyl-2-(2-methylprop-2-enoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[(2S,3R,4S,5R,6R)-2-ethenyl-2-(2-methylprop-2-enoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 166457334 |
| Molecular Formula | C41H40F3N3O5 |
| Molecular Weight | 711.78 g/mol |
| Exact Mass | 711.29 |
| IUPAC Name | 1-[(2S,3R,4S,5R,6R)-2-ethenyl-2-(2-methylprop-2-enoxy)-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-4-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | C=C[C@]1(OCC(=C)C)O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](n2cc(-c3cc(F)c(F)c(F)c3)nn2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H40F3N3O5/c1-4-41(51-23-28(2)3)40(50-26-31-18-12-7-13-19-31)38(47-22-35(45-46-47)32-20-33(42)37(44)34(43)21-32)39(49-25-30-16-10-6-11-17-30)36(52-41)27-48-24-29-14-8-5-9-15-29/h4-22,36,38-40H,1-2,23-27H2,3H3/t36-,38+,39+,40-,41+/m1/s1 |
| InChIKey | HUQHALHDKUHYML-XBELVZINSA-N |
| XLogP | 8.16 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.78 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|