C38H34F3N3O5 — CID 166457384
1-[(5R,7R,8R,9S,10R)-8,10-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]dec-3-en-9-yl]-4-(3,4,5-trifluorophenyl)triazole (PubChem CID 166457384) has the molecular formula C38H34F3N3O5 and a molecular weight of 669.70 g/mol. Its IUPAC name is 1-[(5R,7R,8R,9S,10R)-8,10-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]dec-3-en-9-yl]-4-(3,4,5-trifluorophenyl)triazole.
| Compound Name | 1-[(5R,7R,8R,9S,10R)-8,10-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]dec-3-en-9-yl]-4-(3,4,5-trifluorophenyl)triazole |
|---|---|
| PubChem CID | 166457384 |
| Molecular Formula | C38H34F3N3O5 |
| Molecular Weight | 669.70 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 1-[(5R,7R,8R,9S,10R)-8,10-bis(phenylmethoxy)-7-(phenylmethoxymethyl)-1,6-dioxaspiro[4.5]dec-3-en-9-yl]-4-(3,4,5-trifluorophenyl)triazole |
| SMILES | Fc1cc(-c2cn([C@H]3[C@@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O[C@]4(C=CCO4)[C@@H]3OCc3ccccc3)nn2)cc(F)c1F |
| InChI | InChI=1S/C38H34F3N3O5/c39-30-19-29(20-31(40)34(30)41)32-21-44(43-42-32)35-36(46-23-27-13-6-2-7-14-27)33(25-45-22-26-11-4-1-5-12-26)49-38(17-10-18-48-38)37(35)47-24-28-15-8-3-9-16-28/h1-17,19-21,33,35-37H,18,22-25H2/t33-,35+,36+,37-,38-/m1/s1 |
| InChIKey | ZVSQNRQDZFKZTP-AHGLRNABSA-N |
| XLogP | 6.97 |
| TPSA | 76.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|