C26H26N4O5S — CID 166457536
O-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]] N,N-dimethylcarbamothioate (PubChem CID 166457536) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is O-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]] N,N-dimethylcarbamothioate.
| Compound Name | O-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 166457536 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | O-[[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl]] N,N-dimethylcarbamothioate |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OC(=S)N(C)C)ccc32)cc1 |
| InChI | InChI=1S/C26H26N4O5S/c1-15(31)16-6-8-17(9-7-16)29-23(32)28-13-12-20-22(30(28)24(29)33)19-11-10-18(34-25(36)27(4)5)14-21(19)35-26(20,2)3/h6-12,14,22H,13H2,1-5H3 |
| InChIKey | IMAPKPSFWPNWKF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|