C27H28N4O4 — CID 166457556
15-(4-acetylphenyl)-9,9-dimethyl-5-pyrrolidin-1-yl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione (PubChem CID 166457556) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 15-(4-acetylphenyl)-9,9-dimethyl-5-pyrrolidin-1-yl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione.
| Compound Name | 15-(4-acetylphenyl)-9,9-dimethyl-5-pyrrolidin-1-yl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
|---|---|
| PubChem CID | 166457556 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 15-(4-acetylphenyl)-9,9-dimethyl-5-pyrrolidin-1-yl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(N4CCCC4)ccc32)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-17(32)18-6-8-19(9-7-18)30-25(33)29-15-12-22-24(31(29)26(30)34)21-11-10-20(28-13-4-5-14-28)16-23(21)35-27(22,2)3/h6-12,16,24H,4-5,13-15H2,1-3H3 |
| InChIKey | WAHPQIXVQRFZEI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|