C30H31N5O4 — CID 166457558
15-(4-acetylphenyl)-5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione (PubChem CID 166457558) has the molecular formula C30H31N5O4 and a molecular weight of 525.61 g/mol. Its IUPAC name is 15-(4-acetylphenyl)-5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione.
| Compound Name | 15-(4-acetylphenyl)-5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
|---|---|
| PubChem CID | 166457558 |
| Molecular Formula | C30H31N5O4 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.24 |
| IUPAC Name | 15-(4-acetylphenyl)-5-(1-ethyl-3,5-dimethylpyrazol-4-yl)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
| SMILES | CCn1nc(C)c(-c2ccc3c(c2)OC(C)(C)C2=CCn4c(=O)n(-c5ccc(C(C)=O)cc5)c(=O)n4C23)c1C |
| InChI | InChI=1S/C30H31N5O4/c1-7-32-18(3)26(17(2)31-32)21-10-13-23-25(16-21)39-30(5,6)24-14-15-33-28(37)34(29(38)35(33)27(23)24)22-11-8-20(9-12-22)19(4)36/h8-14,16,27H,7,15H2,1-6H3 |
| InChIKey | POLNXXSLUHKDSL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|