C23H19Cl2N3O5 — CID 166457564
15-(4-acetylphenyl)-4,6-dichloro-5-hydroxy-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraene-14,16-dione (PubChem CID 166457564) has the molecular formula C23H19Cl2N3O5 and a molecular weight of 488.33 g/mol. Its IUPAC name is 15-(4-acetylphenyl)-4,6-dichloro-5-hydroxy-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraene-14,16-dione.
| Compound Name | 15-(4-acetylphenyl)-4,6-dichloro-5-hydroxy-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraene-14,16-dione |
|---|---|
| PubChem CID | 166457564 |
| Molecular Formula | C23H19Cl2N3O5 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 15-(4-acetylphenyl)-4,6-dichloro-5-hydroxy-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,10-tetraene-14,16-dione |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3c2cc(Cl)c(O)c3Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O5/c1-11(29)12-4-6-13(7-5-12)27-21(31)26-9-8-15-18(28(26)22(27)32)14-10-16(24)19(30)17(25)20(14)33-23(15,2)3/h4-8,10,18,30H,9H2,1-3H3 |
| InChIKey | DYRLLGNWWCBARO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|