C28H32N3O8P — CID 166457565
15-(4-acetylphenyl)-5-(diethoxyphosphorylmethoxy)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione (PubChem CID 166457565) has the molecular formula C28H32N3O8P and a molecular weight of 569.55 g/mol. Its IUPAC name is 15-(4-acetylphenyl)-5-(diethoxyphosphorylmethoxy)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione.
| Compound Name | 15-(4-acetylphenyl)-5-(diethoxyphosphorylmethoxy)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
|---|---|
| PubChem CID | 166457565 |
| Molecular Formula | C28H32N3O8P |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | 15-(4-acetylphenyl)-5-(diethoxyphosphorylmethoxy)-9,9-dimethyl-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraene-14,16-dione |
| SMILES | CCOP(=O)(COc1ccc2c(c1)OC(C)(C)C1=CCn3c(=O)n(-c4ccc(C(C)=O)cc4)c(=O)n3C12)OCC |
| InChI | InChI=1S/C28H32N3O8P/c1-6-37-40(35,38-7-2)17-36-21-12-13-22-24(16-21)39-28(4,5)23-14-15-29-26(33)30(27(34)31(29)25(22)23)20-10-8-19(9-11-20)18(3)32/h8-14,16,25H,6-7,15,17H2,1-5H3 |
| InChIKey | YGVXIJNMSKXNBG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|