C33H36N6O7 — CID 166457721
[15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 4-[(2S)-pyrrolidine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 166457721) has the molecular formula C33H36N6O7 and a molecular weight of 628.69 g/mol. Its IUPAC name is [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 4-[(2S)-pyrrolidine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 4-[(2S)-pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166457721 |
| Molecular Formula | C33H36N6O7 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | [15-(4-acetylphenyl)-9,9-dimethyl-14,16-dioxo-8-oxa-13,15,17-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,10-tetraen-5-yl] 4-[(2S)-pyrrolidine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(=O)c1ccc(-n2c(=O)n3n(c2=O)C2C(=CC3)C(C)(C)Oc3cc(OC(=O)N4CCN(C(=O)[C@@H]5CCCN5)CC4)ccc32)cc1 |
| InChI | InChI=1S/C33H36N6O7/c1-20(40)21-6-8-22(9-7-21)38-30(42)37-14-12-25-28(39(37)31(38)43)24-11-10-23(19-27(24)46-33(25,2)3)45-32(44)36-17-15-35(16-18-36)29(41)26-5-4-13-34-26/h6-12,19,26,28,34H,4-5,13-18H2,1-3H3/t26-,28?/m0/s1 |
| InChIKey | YPRQGBCJAREUDY-QODXOHEASA-N |
| XLogP | 2.10 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|