C11H23N3O — CID 16645810
1-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 16645810) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 16645810 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 1-methyl-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | CNC(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-10(2)6-8(13-9(15)12-5)7-11(3,4)14-10/h8,14H,6-7H2,1-5H3,(H2,12,13,15) |
| InChIKey | JSSDVFLUNYTZIP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |