About 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane
4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane (PubChem CID 166460059) has the molecular formula C10H16ClN3
and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane.
Molecular Properties
| Compound Name | 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane |
| PubChem CID | 166460059 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane |
| SMILES | CCC.Nc1nnc(Cl)c2c1CCC2 |
| InChI | InChI=1S/C7H8ClN3.C3H8/c8-6-4-2-1-3-5(4)7(9)11-10-6;1-3-2/h1-3H2,(H2,9,11);3H2,1-2H3 |
| InChIKey | RYSPESJDQGJWHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane?
The IUPAC name of 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane (CID 166460059) is 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane.
What is the SMILES notation for 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane?
The canonical SMILES for 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane is CCC.Nc1nnc(Cl)c2c1CCC2.
What is the InChIKey of 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane?
The InChIKey is RYSPESJDQGJWHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3.C3H8/c8-6-4-2-1-3-5(4)7(9)11-10-6;1-3-2/h1-3H2,(H2,9,11);3H2,1-2H3.
What are the key properties of 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane?
4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane has a molecular weight of 213.71 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyridazin-1-amine;propane is sourced from PubChem (CID 166460059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).