About 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine
7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine (PubChem CID 166460441) has the molecular formula C13H14N4
and a molecular weight of 226.28 g/mol. Its IUPAC name is 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine |
| PubChem CID | 166460441 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine |
| SMILES | Nc1ccc2c(n1)CN(c1cccnc1)CC2 |
| InChI | InChI=1S/C13H14N4/c14-13-4-3-10-5-7-17(9-12(10)16-13)11-2-1-6-15-8-11/h1-4,6,8H,5,7,9H2,(H2,14,16) |
| InChIKey | ILYLOROMTHLRFK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine?
The IUPAC name of 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine (CID 166460441) is 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine.
What is the SMILES notation for 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine?
The canonical SMILES for 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine is Nc1ccc2c(n1)CN(c1cccnc1)CC2.
What is the InChIKey of 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine?
The InChIKey is ILYLOROMTHLRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4/c14-13-4-3-10-5-7-17(9-12(10)16-13)11-2-1-6-15-8-11/h1-4,6,8H,5,7,9H2,(H2,14,16).
What are the key properties of 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine?
7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine has a molecular weight of 226.28 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-3-yl-6,8-dihydro-5H-1,7-naphthyridin-2-amine is sourced from PubChem (CID 166460441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).