About CID 166460715
CID 166460715 (PubChem CID 166460715) has the molecular formula C16H19BrN2O2
and a molecular weight of 351.24 g/mol.
Molecular Properties
| Compound Name | CID 166460715 |
| PubChem CID | 166460715 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | — |
| SMILES | Cc1cc(Br)c(=O)n2c1C(=O)NC21CC2(CCCCC2)C1 |
| InChI | InChI=1S/C16H19BrN2O2/c1-10-7-11(17)14(21)19-12(10)13(20)18-16(19)8-15(9-16)5-3-2-4-6-15/h7H,2-6,8-9H2,1H3,(H,18,20) |
| InChIKey | QJZOINWUKASBHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 166460715 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166460715?
The IUPAC name of CID 166460715 (CID 166460715) is not available.
What is the SMILES notation for CID 166460715?
The canonical SMILES for CID 166460715 is Cc1cc(Br)c(=O)n2c1C(=O)NC21CC2(CCCCC2)C1.
What is the InChIKey of CID 166460715?
The InChIKey is QJZOINWUKASBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O2/c1-10-7-11(17)14(21)19-12(10)13(20)18-16(19)8-15(9-16)5-3-2-4-6-15/h7H,2-6,8-9H2,1H3,(H,18,20).
What are the key properties of CID 166460715?
CID 166460715 has a molecular weight of 351.24 g/mol, XLogP of 3.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166460715 is sourced from PubChem (CID 166460715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).