About CID 166460731
CID 166460731 (PubChem CID 166460731) has the molecular formula C20H24N6O2
and a molecular weight of 380.45 g/mol.
Molecular Properties
| Compound Name | CID 166460731 |
| PubChem CID | 166460731 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CCC2(CCC2)CC1 |
| InChI | InChI=1S/C20H24N6O2/c1-12-9-13(24-15-10-14(21)22-11-23-15)18(28)26-16(12)17(27)25-20(26)7-5-19(6-8-20)3-2-4-19/h9-11H,2-8H2,1H3,(H,25,27)(H3,21,22,23,24) |
| InChIKey | ZWVFVVDLTVFTMX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 166460731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166460731?
The IUPAC name of CID 166460731 (CID 166460731) is not available.
What is the SMILES notation for CID 166460731?
The canonical SMILES for CID 166460731 is Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CCC2(CCC2)CC1.
What is the InChIKey of CID 166460731?
The InChIKey is ZWVFVVDLTVFTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O2/c1-12-9-13(24-15-10-14(21)22-11-23-15)18(28)26-16(12)17(27)25-20(26)7-5-19(6-8-20)3-2-4-19/h9-11H,2-8H2,1H3,(H,25,27)(H3,21,22,23,24).
What are the key properties of CID 166460731?
CID 166460731 has a molecular weight of 380.45 g/mol, XLogP of 2.41, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166460731 is sourced from PubChem (CID 166460731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).