About CID 166460764
CID 166460764 (PubChem CID 166460764) has the molecular formula C23H27N7O3
and a molecular weight of 449.52 g/mol.
Molecular Properties
| Compound Name | CID 166460764 |
| PubChem CID | 166460764 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CNC2 |
| InChI | InChI=1S/C23H27N7O3/c1-13-8-15(27-16-9-17(26-12-25-16)28-19(31)14-2-3-14)21(33)30-18(13)20(32)29-23(30)6-4-22(5-7-23)10-24-11-22/h8-9,12,14,24H,2-7,10-11H2,1H3,(H,29,32)(H2,25,26,27,28,31) |
| InChIKey | UURPRFWHCGCEMR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 166460764 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166460764?
The IUPAC name of CID 166460764 (CID 166460764) is not available.
What is the SMILES notation for CID 166460764?
The canonical SMILES for CID 166460764 is Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CNC2.
What is the InChIKey of CID 166460764?
The InChIKey is UURPRFWHCGCEMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N7O3/c1-13-8-15(27-16-9-17(26-12-25-16)28-19(31)14-2-3-14)21(33)30-18(13)20(32)29-23(30)6-4-22(5-7-23)10-24-11-22/h8-9,12,14,24H,2-7,10-11H2,1H3,(H,29,32)(H2,25,26,27,28,31).
What are the key properties of CID 166460764?
CID 166460764 has a molecular weight of 449.52 g/mol, XLogP of 1.60, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166460764 is sourced from PubChem (CID 166460764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).