About CID 166460765
CID 166460765 (PubChem CID 166460765) has the molecular formula C15H15BrF2N2O2
and a molecular weight of 373.20 g/mol.
Molecular Properties
| Compound Name | CID 166460765 |
| PubChem CID | 166460765 |
| Molecular Formula | C15H15BrF2N2O2 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | — |
| SMILES | Cc1cc(Br)c(=O)n2c1C(=O)NC21CCC2(CC1)CC2(F)F |
| InChI | InChI=1S/C15H15BrF2N2O2/c1-8-6-9(16)12(22)20-10(8)11(21)19-14(20)4-2-13(3-5-14)7-15(13,17)18/h6H,2-5,7H2,1H3,(H,19,21) |
| InChIKey | BZLHXTOCYFFJAV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 166460765 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166460765?
The IUPAC name of CID 166460765 (CID 166460765) is not available.
What is the SMILES notation for CID 166460765?
The canonical SMILES for CID 166460765 is Cc1cc(Br)c(=O)n2c1C(=O)NC21CCC2(CC1)CC2(F)F.
What is the InChIKey of CID 166460765?
The InChIKey is BZLHXTOCYFFJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrF2N2O2/c1-8-6-9(16)12(22)20-10(8)11(21)19-14(20)4-2-13(3-5-14)7-15(13,17)18/h6H,2-5,7H2,1H3,(H,19,21).
What are the key properties of CID 166460765?
CID 166460765 has a molecular weight of 373.20 g/mol, XLogP of 2.91, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166460765 is sourced from PubChem (CID 166460765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).