About CID 166460767
CID 166460767 (PubChem CID 166460767) has the molecular formula C22H25N7O3
and a molecular weight of 435.49 g/mol.
Molecular Properties
| Compound Name | CID 166460767 |
| PubChem CID | 166460767 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CN2 |
| InChI | InChI=1S/C22H25N7O3/c1-12-8-14(26-15-9-16(24-11-23-15)27-18(30)13-2-3-13)20(32)29-17(12)19(31)28-22(29)6-4-21(5-7-22)10-25-21/h8-9,11,13,25H,2-7,10H2,1H3,(H,28,31)(H2,23,24,26,27,30) |
| InChIKey | YWTOXDZUCRZYMW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 166460767 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166460767?
The IUPAC name of CID 166460767 (CID 166460767) is not available.
What is the SMILES notation for CID 166460767?
The canonical SMILES for CID 166460767 is Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CN2.
What is the InChIKey of CID 166460767?
The InChIKey is YWTOXDZUCRZYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N7O3/c1-12-8-14(26-15-9-16(24-11-23-15)27-18(30)13-2-3-13)20(32)29-17(12)19(31)28-22(29)6-4-21(5-7-22)10-25-21/h8-9,11,13,25H,2-7,10H2,1H3,(H,28,31)(H2,23,24,26,27,30).
What are the key properties of CID 166460767?
CID 166460767 has a molecular weight of 435.49 g/mol, XLogP of 1.35, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166460767 is sourced from PubChem (CID 166460767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).