C25H24FN5OS — CID 166461326
(15R)-5-(2-fluoro-5-piperazin-1-ylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one (PubChem CID 166461326) has the molecular formula C25H24FN5OS and a molecular weight of 461.57 g/mol. Its IUPAC name is (15R)-5-(2-fluoro-5-piperazin-1-ylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one.
| Compound Name | (15R)-5-(2-fluoro-5-piperazin-1-ylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
|---|---|
| PubChem CID | 166461326 |
| Molecular Formula | C25H24FN5OS |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (15R)-5-(2-fluoro-5-piperazin-1-ylphenyl)-15-methyl-11-thia-6,14,17-triazatetracyclo[8.8.0.02,7.012,18]octadeca-1(10),2(7),3,5,8,12(18)-hexaen-13-one |
| SMILES | C[C@@H]1CNc2c(sc3ccc4nc(-c5cc(N6CCNCC6)ccc5F)ccc4c23)C(=O)N1 |
| InChI | InChI=1S/C25H24FN5OS/c1-14-13-28-23-22-16-3-5-20(30-19(16)6-7-21(22)33-24(23)25(32)29-14)17-12-15(2-4-18(17)26)31-10-8-27-9-11-31/h2-7,12,14,27-28H,8-11,13H2,1H3,(H,29,32)/t14-/m1/s1 |
| InChIKey | YPPIOAXSGWMAHL-CQSZACIVSA-N |
| XLogP | 4.21 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |