C27H28Cl2N4O2 — CID 166462148
4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(spiro[3,4-dihydrochromene-2,4'-piperidine]-6-carboximidoyl)aniline (PubChem CID 166462148) has the molecular formula C27H28Cl2N4O2 and a molecular weight of 511.45 g/mol. Its IUPAC name is 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(spiro[3,4-dihydrochromene-2,4'-piperidine]-6-carboximidoyl)aniline.
| Compound Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(spiro[3,4-dihydrochromene-2,4'-piperidine]-6-carboximidoyl)aniline |
|---|---|
| PubChem CID | 166462148 |
| Molecular Formula | C27H28Cl2N4O2 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 4-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-2-(spiro[3,4-dihydrochromene-2,4'-piperidine]-6-carboximidoyl)aniline |
| SMILES | [H]/N=C(\c1ccc2c(c1)CCC1(CCNCC1)O2)c1cc(O[C@H](C)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C27H28Cl2N4O2/c1-16(25-21(28)14-33-15-22(25)29)34-19-3-4-23(30)20(13-19)26(31)18-2-5-24-17(12-18)6-7-27(35-24)8-10-32-11-9-27/h2-5,12-16,31-32H,6-11,30H2,1H3/b31-26+/t16-/m1/s1 |
| InChIKey | JZNIFWRMNLDZEC-CIEMOSNWSA-N |
| XLogP | 5.97 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|