C27H23Cl2N7O3 — CID 166462355
[7-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]-(2-methyl-3-pyridinyl)methanone (PubChem CID 166462355) has the molecular formula C27H23Cl2N7O3 and a molecular weight of 564.43 g/mol. Its IUPAC name is [7-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]-(2-methyl-3-pyridinyl)methanone.
| Compound Name | [7-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]-(2-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 166462355 |
| Molecular Formula | C27H23Cl2N7O3 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | [7-[2-amino-5-[(S)-amino-(3,5-dichloro-4-pyridinyl)methoxy]benzenecarboximidoyl]-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl]-(2-methyl-3-pyridinyl)methanone |
| SMILES | [H]/N=C(\c1cnc2c(c1)N(C(=O)c1cccnc1C)CCO2)c1cc(O[C@H](N)c2c(Cl)cncc2Cl)ccc1N |
| InChI | InChI=1S/C27H23Cl2N7O3/c1-14-17(3-2-6-34-14)27(37)36-7-8-38-26-22(36)9-15(11-35-26)24(31)18-10-16(4-5-21(18)30)39-25(32)23-19(28)12-33-13-20(23)29/h2-6,9-13,25,31H,7-8,30,32H2,1H3/b31-24+/t25-/m0/s1 |
| InChIKey | SKCASGFQBQSKEY-ZRRPGFMYSA-N |
| XLogP | 4.56 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|