About 2-(dodecanoylamino)ethyl 2-aminoacetate
2-(dodecanoylamino)ethyl 2-aminoacetate (PubChem CID 166463267) has the molecular formula C16H32N2O3
and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-(dodecanoylamino)ethyl 2-aminoacetate.
Molecular Properties
| Compound Name | 2-(dodecanoylamino)ethyl 2-aminoacetate |
| PubChem CID | 166463267 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 2-(dodecanoylamino)ethyl 2-aminoacetate |
| SMILES | CCCCCCCCCCCC(=O)NCCOC(=O)CN |
| InChI | InChI=1S/C16H32N2O3/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-12-13-21-16(20)14-17/h2-14,17H2,1H3,(H,18,19) |
| InChIKey | OUONUUKGZOIFTF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dodecanoylamino)ethyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dodecanoylamino)ethyl 2-aminoacetate?
The IUPAC name of 2-(dodecanoylamino)ethyl 2-aminoacetate (CID 166463267) is 2-(dodecanoylamino)ethyl 2-aminoacetate.
What is the SMILES notation for 2-(dodecanoylamino)ethyl 2-aminoacetate?
The canonical SMILES for 2-(dodecanoylamino)ethyl 2-aminoacetate is CCCCCCCCCCCC(=O)NCCOC(=O)CN.
What is the InChIKey of 2-(dodecanoylamino)ethyl 2-aminoacetate?
The InChIKey is OUONUUKGZOIFTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O3/c1-2-3-4-5-6-7-8-9-10-11-15(19)18-12-13-21-16(20)14-17/h2-14,17H2,1H3,(H,18,19).
What are the key properties of 2-(dodecanoylamino)ethyl 2-aminoacetate?
2-(dodecanoylamino)ethyl 2-aminoacetate has a molecular weight of 300.44 g/mol, XLogP of 2.53, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dodecanoylamino)ethyl 2-aminoacetate is sourced from PubChem (CID 166463267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).