C28H34ClF2N6O5+ — CID 166463481
[[(E)-3-[[2-chloro-4-[[5-(2,3-difluoro-4-methoxyphenyl)-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]-2-methylprop-1-enyl]-[2-(2-hydroxyethoxy)ethyl]amino]-methylazanium (PubChem CID 166463481) has the molecular formula C28H34ClF2N6O5+ and a molecular weight of 608.07 g/mol. Its IUPAC name is [[(E)-3-[[2-chloro-4-[[5-(2,3-difluoro-4-methoxyphenyl)-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]-2-methylprop-1-enyl]-[2-(2-hydroxyethoxy)ethyl]amino]-methylazanium.
| Compound Name | [[(E)-3-[[2-chloro-4-[[5-(2,3-difluoro-4-methoxyphenyl)-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]-2-methylprop-1-enyl]-[2-(2-hydroxyethoxy)ethyl]amino]-methylazanium |
|---|---|
| PubChem CID | 166463481 |
| Molecular Formula | C28H34ClF2N6O5+ |
| Molecular Weight | 608.07 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | [[(E)-3-[[2-chloro-4-[[5-(2,3-difluoro-4-methoxyphenyl)-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]-2-methylprop-1-enyl]-[2-(2-hydroxyethoxy)ethyl]amino]-methylazanium |
| SMILES | C[NH2+]N(/C=C(\C)CNC(=O)c1ccc(NC(=O)c2ncc(-c3ccc(OC)c(F)c3F)n2C)cc1Cl)CCOCCO |
| InChI | InChI=1S/C28H33ClF2N6O5/c1-17(16-37(32-2)9-11-42-12-10-38)14-34-27(39)19-6-5-18(13-21(19)29)35-28(40)26-33-15-22(36(26)3)20-7-8-23(41-4)25(31)24(20)30/h5-8,13,15-16,32,38H,9-12,14H2,1-4H3,(H,34,39)(H,35,40)/p+1/b17-16+ |
| InChIKey | KVFGTIXXGSXCLI-WUKNDPDISA-O |
| XLogP | 2.33 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|