C28H30ClF2N7O6 — CID 166463688
[2-[2-[[2-chloro-4-[[5-[4-(cyanomethoxy)-2,3-difluorophenyl]-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]ethylamino]-2-oxoethyl]-trimethylazanium formate (PubChem CID 166463688) has the molecular formula C28H30ClF2N7O6 and a molecular weight of 634.04 g/mol. Its IUPAC name is [2-[2-[[2-chloro-4-[[5-[4-(cyanomethoxy)-2,3-difluorophenyl]-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]ethylamino]-2-oxoethyl]-trimethylazanium formate.
| Compound Name | [2-[2-[[2-chloro-4-[[5-[4-(cyanomethoxy)-2,3-difluorophenyl]-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]ethylamino]-2-oxoethyl]-trimethylazanium formate |
|---|---|
| PubChem CID | 166463688 |
| Molecular Formula | C28H30ClF2N7O6 |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | [2-[2-[[2-chloro-4-[[5-[4-(cyanomethoxy)-2,3-difluorophenyl]-1-methylimidazole-2-carbonyl]amino]benzoyl]amino]ethylamino]-2-oxoethyl]-trimethylazanium formate |
| SMILES | Cn1c(-c2ccc(OCC#N)c(F)c2F)cnc1C(=O)Nc1ccc(C(=O)NCCNC(=O)C[N+](C)(C)C)c(Cl)c1.O=C[O-] |
| InChI | InChI=1S/C27H28ClF2N7O4.CH2O2/c1-36-20(18-7-8-21(41-12-9-31)24(30)23(18)29)14-34-25(36)27(40)35-16-5-6-17(19(28)13-16)26(39)33-11-10-32-22(38)15-37(2,3)4;2-1-3/h5-8,13-14H,10-12,15H2,1-4H3,(H2-,32,33,35,38,39,40);1H,(H,2,3) |
| InChIKey | VOUWXISZUUDMMX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 178.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|