About 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one
5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one (PubChem CID 166463846) has the molecular formula C21H21IO9
and a molecular weight of 544.29 g/mol. Its IUPAC name is 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one.
Molecular Properties
| Compound Name | 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one |
| PubChem CID | 166463846 |
| Molecular Formula | C21H21IO9 |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 544.02 |
| IUPAC Name | 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one |
| SMILES | COCOc1ccc(-c2oc3cc(OCOC)c(I)c(O)c3c(=O)c2OCOC)cc1 |
| InChI | InChI=1S/C21H21IO9/c1-25-9-28-13-6-4-12(5-7-13)20-21(30-11-27-3)19(24)16-14(31-20)8-15(29-10-26-2)17(22)18(16)23/h4-8,23H,9-11H2,1-3H3 |
| InChIKey | YQMDXDAYUUGNBK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one?
The IUPAC name of 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one (CID 166463846) is 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one.
What is the SMILES notation for 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one?
The canonical SMILES for 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one is COCOc1ccc(-c2oc3cc(OCOC)c(I)c(O)c3c(=O)c2OCOC)cc1.
What is the InChIKey of 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one?
The InChIKey is YQMDXDAYUUGNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21IO9/c1-25-9-28-13-6-4-12(5-7-13)20-21(30-11-27-3)19(24)16-14(31-20)8-15(29-10-26-2)17(22)18(16)23/h4-8,23H,9-11H2,1-3H3.
What are the key properties of 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one?
5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one has a molecular weight of 544.29 g/mol, XLogP of 3.72, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-iodo-3,7-bis(methoxymethoxy)-2-[4-(methoxymethoxy)phenyl]chromen-4-one is sourced from PubChem (CID 166463846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).