C11H22OS — CID 166463900
(2R)-4-(ethylsulfanylmethyl)-2,6-dimethylcyclohexan-1-ol (PubChem CID 166463900) has the molecular formula C11H22OS and a molecular weight of 202.36 g/mol. Its IUPAC name is (2R)-4-(ethylsulfanylmethyl)-2,6-dimethylcyclohexan-1-ol.
| Compound Name | (2R)-4-(ethylsulfanylmethyl)-2,6-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 166463900 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (2R)-4-(ethylsulfanylmethyl)-2,6-dimethylcyclohexan-1-ol |
| SMILES | CCSCC1CC(C)C(O)[C@H](C)C1 |
| InChI | InChI=1S/C11H22OS/c1-4-13-7-10-5-8(2)11(12)9(3)6-10/h8-12H,4-7H2,1-3H3/t8-,9?,10?,11?/m1/s1 |
| InChIKey | QDACIFMWSNWGAS-XUHYKBHQSA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |