About 8-chloro-1,3,9-trimethyl-9-phenylfluorene
8-chloro-1,3,9-trimethyl-9-phenylfluorene (PubChem CID 166464539) has the molecular formula C22H19Cl
and a molecular weight of 318.85 g/mol. Its IUPAC name is 8-chloro-1,3,9-trimethyl-9-phenylfluorene.
Molecular Properties
| Compound Name | 8-chloro-1,3,9-trimethyl-9-phenylfluorene |
| PubChem CID | 166464539 |
| Molecular Formula | C22H19Cl |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 8-chloro-1,3,9-trimethyl-9-phenylfluorene |
| SMILES | Cc1cc(C)c2c(c1)-c1cccc(Cl)c1C2(C)c1ccccc1 |
| InChI | InChI=1S/C22H19Cl/c1-14-12-15(2)20-18(13-14)17-10-7-11-19(23)21(17)22(20,3)16-8-5-4-6-9-16/h4-13H,1-3H3 |
| InChIKey | JCRWGHRAWYWJSE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8-chloro-1,3,9-trimethyl-9-phenylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1,3,9-trimethyl-9-phenylfluorene?
The IUPAC name of 8-chloro-1,3,9-trimethyl-9-phenylfluorene (CID 166464539) is 8-chloro-1,3,9-trimethyl-9-phenylfluorene.
What is the SMILES notation for 8-chloro-1,3,9-trimethyl-9-phenylfluorene?
The canonical SMILES for 8-chloro-1,3,9-trimethyl-9-phenylfluorene is Cc1cc(C)c2c(c1)-c1cccc(Cl)c1C2(C)c1ccccc1.
What is the InChIKey of 8-chloro-1,3,9-trimethyl-9-phenylfluorene?
The InChIKey is JCRWGHRAWYWJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Cl/c1-14-12-15(2)20-18(13-14)17-10-7-11-19(23)21(17)22(20,3)16-8-5-4-6-9-16/h4-13H,1-3H3.
What are the key properties of 8-chloro-1,3,9-trimethyl-9-phenylfluorene?
8-chloro-1,3,9-trimethyl-9-phenylfluorene has a molecular weight of 318.85 g/mol, XLogP of 6.29, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1,3,9-trimethyl-9-phenylfluorene is sourced from PubChem (CID 166464539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).