About 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium
6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium (PubChem CID 166464677) has the molecular formula C11H12NO2Y-
and a molecular weight of 279.13 g/mol. Its IUPAC name is 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium.
Molecular Properties
| Compound Name | 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium |
| PubChem CID | 166464677 |
| Molecular Formula | C11H12NO2Y- |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium |
| SMILES | COc1[c-]cc2c(c1)CCN(C)C2=O.[Y] |
| InChI | InChI=1S/C11H12NO2.Y/c1-12-6-5-8-7-9(14-2)3-4-10(8)11(12)13;/h4,7H,5-6H2,1-2H3;/q-1; |
| InChIKey | KCROEKUARVERRO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium?
The IUPAC name of 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium (CID 166464677) is 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium.
What is the SMILES notation for 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium?
The canonical SMILES for 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium is COc1[c-]cc2c(c1)CCN(C)C2=O.[Y].
What is the InChIKey of 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium?
The InChIKey is KCROEKUARVERRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12NO2.Y/c1-12-6-5-8-7-9(14-2)3-4-10(8)11(12)13;/h4,7H,5-6H2,1-2H3;/q-1;.
What are the key properties of 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium?
6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium has a molecular weight of 279.13 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2-methyl-4,7-dihydro-3H-isoquinolin-7-id-1-one;yttrium is sourced from PubChem (CID 166464677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).