About N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine
N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine (PubChem CID 166464684) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine.
Molecular Properties
| Compound Name | N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine |
| PubChem CID | 166464684 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine |
| SMILES | CC/C(=N\C)C1=C(C)CNC1 |
| InChI | InChI=1S/C9H16N2/c1-4-9(10-3)8-6-11-5-7(8)2/h11H,4-6H2,1-3H3/b10-9+ |
| InChIKey | WIJHCNMWMNQJKM-MDZDMXLPSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine?
The IUPAC name of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine (CID 166464684) is N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine.
What is the SMILES notation for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine?
The canonical SMILES for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine is CC/C(=N\C)C1=C(C)CNC1.
What is the InChIKey of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine?
The InChIKey is WIJHCNMWMNQJKM-MDZDMXLPSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-9(10-3)8-6-11-5-7(8)2/h11H,4-6H2,1-3H3/b10-9+.
What are the key properties of N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine?
N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine has a molecular weight of 152.24 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-methyl-2,5-dihydro-1H-pyrrol-3-yl)propan-1-imine is sourced from PubChem (CID 166464684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).