C17H38N2O2 — CID 166464908
5-(2-amino-2-methylpropoxy)-2,2,3,5-tetramethylhexanamide;propane (PubChem CID 166464908) has the molecular formula C17H38N2O2 and a molecular weight of 302.50 g/mol. Its IUPAC name is 5-(2-amino-2-methylpropoxy)-2,2,3,5-tetramethylhexanamide;propane.
| Compound Name | 5-(2-amino-2-methylpropoxy)-2,2,3,5-tetramethylhexanamide;propane |
|---|---|
| PubChem CID | 166464908 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | 5-(2-amino-2-methylpropoxy)-2,2,3,5-tetramethylhexanamide;propane |
| SMILES | CC(CC(C)(C)OCC(C)(C)N)C(C)(C)C(N)=O.CCC |
| InChI | InChI=1S/C14H30N2O2.C3H8/c1-10(14(6,7)11(15)17)8-13(4,5)18-9-12(2,3)16;1-3-2/h10H,8-9,16H2,1-7H3,(H2,15,17);3H2,1-2H3 |
| InChIKey | BHBFJBACAVTTGX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |