C17H8F3NO3 — CID 166464978
(3E)-3-(2,2,2-trifluoro-1-hydroxyethylidene)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione (PubChem CID 166464978) has the molecular formula C17H8F3NO3 and a molecular weight of 331.25 g/mol. Its IUPAC name is (3E)-3-(2,2,2-trifluoro-1-hydroxyethylidene)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione.
| Compound Name | (3E)-3-(2,2,2-trifluoro-1-hydroxyethylidene)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
|---|---|
| PubChem CID | 166464978 |
| Molecular Formula | C17H8F3NO3 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | (3E)-3-(2,2,2-trifluoro-1-hydroxyethylidene)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaene-2,4-dione |
| SMILES | O=c1/c(=C(\O)C(F)(F)F)c(=O)n2c3ccccc3c3cccc1c32 |
| InChI | InChI=1S/C17H8F3NO3/c18-17(19,20)15(23)12-14(22)10-6-3-5-9-8-4-1-2-7-11(8)21(13(9)10)16(12)24/h1-7,23H/b15-12+ |
| InChIKey | SXJCIEZGVKFQGQ-NTCAYCPXSA-N |
| XLogP | 2.35 |
| TPSA | 58.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |