About 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one
4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one (PubChem CID 166464996) has the molecular formula C22H11F6NO3
and a molecular weight of 451.32 g/mol. Its IUPAC name is 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one |
| PubChem CID | 166464996 |
| Molecular Formula | C22H11F6NO3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one |
| SMILES | O=C(c1c(O)c2ccc3ccccc3c2n(-c2ccc(C(F)(F)F)cc2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C22H11F6NO3/c23-21(24,25)12-6-8-13(9-7-12)29-17-14-4-2-1-3-11(14)5-10-15(17)18(30)16(20(29)32)19(31)22(26,27)28/h1-10,30H |
| InChIKey | WXVFROQNYZHJBO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one?
The IUPAC name of 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one (CID 166464996) is 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one.
What is the SMILES notation for 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one?
The canonical SMILES for 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one is O=C(c1c(O)c2ccc3ccccc3c2n(-c2ccc(C(F)(F)F)cc2)c1=O)C(F)(F)F.
What is the InChIKey of 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one?
The InChIKey is WXVFROQNYZHJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11F6NO3/c23-21(24,25)12-6-8-13(9-7-12)29-17-14-4-2-1-3-11(14)5-10-15(17)18(30)16(20(29)32)19(31)22(26,27)28/h1-10,30H.
What are the key properties of 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one?
4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one has a molecular weight of 451.32 g/mol, XLogP of 5.61, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-(2,2,2-trifluoroacetyl)-1-[4-(trifluoromethyl)phenyl]benzo[h]quinolin-2-one is sourced from PubChem (CID 166464996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).