About 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one
6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one (PubChem CID 166465088) has the molecular formula C15H17Cl2N5OS
and a molecular weight of 386.31 g/mol. Its IUPAC name is 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one |
| PubChem CID | 166465088 |
| Molecular Formula | C15H17Cl2N5OS |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one |
| SMILES | Cn1c(N2CCNCC2)nc(N)c(Sc2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C15H17Cl2N5OS/c1-21-14(23)12(24-10-4-2-3-9(16)11(10)17)13(18)20-15(21)22-7-5-19-6-8-22/h2-4,19H,5-8,18H2,1H3 |
| InChIKey | LLXIBRPEMRZCTC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one?
The IUPAC name of 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one (CID 166465088) is 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one.
What is the SMILES notation for 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one?
The canonical SMILES for 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one is Cn1c(N2CCNCC2)nc(N)c(Sc2cccc(Cl)c2Cl)c1=O.
What is the InChIKey of 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one?
The InChIKey is LLXIBRPEMRZCTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17Cl2N5OS/c1-21-14(23)12(24-10-4-2-3-9(16)11(10)17)13(18)20-15(21)22-7-5-19-6-8-22/h2-4,19H,5-8,18H2,1H3.
What are the key properties of 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one?
6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one has a molecular weight of 386.31 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(2,3-dichlorophenyl)sulfanyl-3-methyl-2-piperazin-1-ylpyrimidin-4-one is sourced from PubChem (CID 166465088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).