C24H34N2O5 — CID 166466274
methyl (1R,2S,3S,6R,7S)-4-[(2S)-2-(1-ethenylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate (PubChem CID 166466274) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is methyl (1R,2S,3S,6R,7S)-4-[(2S)-2-(1-ethenylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,6R,7S)-4-[(2S)-2-(1-ethenylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 166466274 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | methyl (1R,2S,3S,6R,7S)-4-[(2S)-2-(1-ethenylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
| SMILES | C=CC1([C@H](NC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)OC)[C@H]2C=C[C@@H]3C2)CCC1 |
| InChI | InChI=1S/C24H34N2O5/c1-6-24(10-7-11-24)19(25-22(29)31-23(2,3)4)20(27)26-13-16-14-8-9-15(12-14)17(16)18(26)21(28)30-5/h6,8-9,14-19H,1,7,10-13H2,2-5H3,(H,25,29)/t14-,15+,16-,17+,18+,19-/m1/s1 |
| InChIKey | XZNNQWUGMBRDHZ-UWVPOSKDSA-N |
| XLogP | 3.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|