C29H45F3N2O9 — CID 166466353
tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-1,1,1-trifluorobut-3-en-2-yl]carbamoyl]pent-4-enoate (PubChem CID 166466353) has the molecular formula C29H45F3N2O9 and a molecular weight of 622.68 g/mol. Its IUPAC name is tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-1,1,1-trifluorobut-3-en-2-yl]carbamoyl]pent-4-enoate.
| Compound Name | tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-1,1,1-trifluorobut-3-en-2-yl]carbamoyl]pent-4-enoate |
|---|---|
| PubChem CID | 166466353 |
| Molecular Formula | C29H45F3N2O9 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.31 |
| IUPAC Name | tert-butyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonyl-[(2R)-1,1,1-trifluorobut-3-en-2-yl]carbamoyl]pent-4-enoate |
| SMILES | C=C[C@@H](N(C(=O)OC(C)(C)C)C(=O)C(=C)C[C@@H](C(=O)OC(C)(C)C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C29H45F3N2O9/c1-15-19(29(30,31)32)34(24(39)43-28(12,13)14)20(35)17(2)16-18(21(36)40-25(3,4)5)33(22(37)41-26(6,7)8)23(38)42-27(9,10)11/h15,18-19H,1-2,16H2,3-14H3/t18-,19+/m0/s1 |
| InChIKey | MGADTNITBMDPBR-RBUKOAKNSA-N |
| XLogP | 6.70 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|