C22H32F2N2O5 — CID 166466456
methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-10,10-difluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate (PubChem CID 166466456) has the molecular formula C22H32F2N2O5 and a molecular weight of 442.50 g/mol. Its IUPAC name is methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-10,10-difluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate.
| Compound Name | methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-10,10-difluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 166466456 |
| Molecular Formula | C22H32F2N2O5 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-10,10-difluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)[C@@H]1C=C[C@H]2C1(F)F |
| InChI | InChI=1S/C22H32F2N2O5/c1-20(2,3)16(25-19(29)31-21(4,5)6)17(27)26-10-11-12-8-9-13(22(12,23)24)14(11)15(26)18(28)30-7/h8-9,11-16H,10H2,1-7H3,(H,25,29)/t11-,12+,13-,14-,15+,16-/m1/s1 |
| InChIKey | KSJRFNUCKDRSQA-GTDBDLECSA-N |
| XLogP | 2.99 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|