C20H27NO9S — CID 166466461
1-O-tert-butyl 2-O-methyl (2S,4S)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 166466461) has the molecular formula C20H27NO9S and a molecular weight of 457.50 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166466461 |
| Molecular Formula | C20H27NO9S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-[2-(4-methylphenyl)sulfonyloxyethoxy]-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OCCOS(=O)(=O)c2ccc(C)cc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27NO9S/c1-13-6-8-14(9-7-13)31(25,26)29-11-10-28-16-12-15(18(23)27-5)21(17(16)22)19(24)30-20(2,3)4/h6-9,15-16H,10-12H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | MMLULPSKWPVCBK-HOTGVXAUSA-N |
| XLogP | 1.79 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|