C21H30F2N2O6 — CID 166466486
methyl (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate (PubChem CID 166466486) has the molecular formula C21H30F2N2O6 and a molecular weight of 444.48 g/mol. Its IUPAC name is methyl (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 166466486 |
| Molecular Formula | C21H30F2N2O6 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)OC(F)F)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C21H30F2N2O6/c1-10(30-19(22)23)15(24-20(28)31-21(2,3)4)17(26)25-9-13-11-6-7-12(8-11)14(13)16(25)18(27)29-5/h6-7,10-16,19H,8-9H2,1-5H3,(H,24,28)/t10-,11-,12+,13-,14+,15+,16+/m1/s1 |
| InChIKey | ZYFQYKHVYDLGBY-LDJVBQEQSA-N |
| XLogP | 2.33 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|