C19H23F5N2O4 — CID 166466573
(1R,2S,3S,6R,7S)-4-[(2S)-3,3-dimethyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid (PubChem CID 166466573) has the molecular formula C19H23F5N2O4 and a molecular weight of 438.39 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S)-4-[(2S)-3,3-dimethyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid.
| Compound Name | (1R,2S,3S,6R,7S)-4-[(2S)-3,3-dimethyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 166466573 |
| Molecular Formula | C19H23F5N2O4 |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (1R,2S,3S,6R,7S)-4-[(2S)-3,3-dimethyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C19H23F5N2O4/c1-17(2,3)13(25-16(30)18(20,21)19(22,23)24)14(27)26-7-10-8-4-5-9(6-8)11(10)12(26)15(28)29/h4-5,8-13H,6-7H2,1-3H3,(H,25,30)(H,28,29)/t8-,9+,10-,11+,12+,13-/m1/s1 |
| InChIKey | KIYURMFAHGBOPZ-NMIFLECGSA-N |
| XLogP | 2.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|