C22H33FN2O5 — CID 166466586
methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6-fluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate (PubChem CID 166466586) has the molecular formula C22H33FN2O5 and a molecular weight of 424.51 g/mol. Its IUPAC name is methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6-fluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate.
| Compound Name | methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6-fluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
|---|---|
| PubChem CID | 166466586 |
| Molecular Formula | C22H33FN2O5 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | methyl (1R,2R,3S,6S,7S)-4-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-6-fluoro-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2[C@H]3C=C[C@H](C3)[C@@]2(F)CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H33FN2O5/c1-20(2,3)16(24-19(28)30-21(4,5)6)17(26)25-11-22(23)13-9-8-12(10-13)14(22)15(25)18(27)29-7/h8-9,12-16H,10-11H2,1-7H3,(H,24,28)/t12-,13+,14+,15-,16+,22-/m0/s1 |
| InChIKey | HXUCNFCBQHHAOV-LMORCMIDSA-N |
| XLogP | 2.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|