C8H11NO — CID 166466598
(3aS,4R,7S,7aR)-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindole (PubChem CID 166466598) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (3aS,4R,7S,7aR)-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindole.
| Compound Name | (3aS,4R,7S,7aR)-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 166466598 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (3aS,4R,7S,7aR)-3a,4,5,6,7,7a-hexahydro-1H-4,7-epoxyisoindole |
| SMILES | C1=NC[C@H]2[C@@H]1[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C8H11NO/c1-2-8-6-4-9-3-5(6)7(1)10-8/h3,5-8H,1-2,4H2/t5-,6+,7-,8+/m1/s1 |
| InChIKey | SBGRVHYGLBXTET-CWKFCGSDSA-N |
| XLogP | 0.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |