C20H23F5N2O5 — CID 166466627
(1R,2S,3S,6R,7S)-4-[(2S,3R)-3-cyclopropyloxy-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid (PubChem CID 166466627) has the molecular formula C20H23F5N2O5 and a molecular weight of 466.40 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-cyclopropyloxy-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid.
| Compound Name | (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-cyclopropyloxy-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 166466627 |
| Molecular Formula | C20H23F5N2O5 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (1R,2S,3S,6R,7S)-4-[(2S,3R)-3-cyclopropyloxy-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3-carboxylic acid |
| SMILES | C[C@@H](OC1CC1)[C@H](NC(=O)C(F)(F)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C20H23F5N2O5/c1-8(32-11-4-5-11)14(26-18(31)19(21,22)20(23,24)25)16(28)27-7-12-9-2-3-10(6-9)13(12)15(27)17(29)30/h2-3,8-15H,4-7H2,1H3,(H,26,31)(H,29,30)/t8-,9-,10+,12-,13+,14+,15+/m1/s1 |
| InChIKey | GGRFHQWAXAKQKN-YSSGFTCESA-N |
| XLogP | 1.97 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|