About N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen
N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen (PubChem CID 166466859) has the molecular formula C17H34F2N2O2
and a molecular weight of 336.47 g/mol. Its IUPAC name is N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen |
| PubChem CID | 166466859 |
| Molecular Formula | C17H34F2N2O2 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen |
| SMILES | CCOCCCCCN1CCC(NC(=O)C(C)CC)C(F)(F)C1.[H][H] |
| InChI | InChI=1S/C17H32F2N2O2.H2/c1-4-14(3)16(22)20-15-9-11-21(13-17(15,18)19)10-7-6-8-12-23-5-2;/h14-15H,4-13H2,1-3H3,(H,20,22);1H |
| InChIKey | LBQHLQXUXAHJEG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen?
The IUPAC name of N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen (CID 166466859) is N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen.
What is the SMILES notation for N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen?
The canonical SMILES for N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen is CCOCCCCCN1CCC(NC(=O)C(C)CC)C(F)(F)C1.[H][H].
What is the InChIKey of N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen?
The InChIKey is LBQHLQXUXAHJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32F2N2O2.H2/c1-4-14(3)16(22)20-15-9-11-21(13-17(15,18)19)10-7-6-8-12-23-5-2;/h14-15H,4-13H2,1-3H3,(H,20,22);1H.
What are the key properties of N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen?
N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen has a molecular weight of 336.47 g/mol, XLogP of 3.31, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5-ethoxypentyl)-3,3-difluoropiperidin-4-yl]-2-methylbutanamide;molecular hydrogen is sourced from PubChem (CID 166466859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).