C16H32F2N2O2 — CID 166466896
N-[1-(5-ethoxy-2,2-difluoropentyl)piperidin-4-yl]-2-methylpropanamide;molecular hydrogen (PubChem CID 166466896) has the molecular formula C16H32F2N2O2 and a molecular weight of 322.44 g/mol. Its IUPAC name is N-[1-(5-ethoxy-2,2-difluoropentyl)piperidin-4-yl]-2-methylpropanamide;molecular hydrogen.
| Compound Name | N-[1-(5-ethoxy-2,2-difluoropentyl)piperidin-4-yl]-2-methylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166466896 |
| Molecular Formula | C16H32F2N2O2 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | N-[1-(5-ethoxy-2,2-difluoropentyl)piperidin-4-yl]-2-methylpropanamide;molecular hydrogen |
| SMILES | CCOCCCC(F)(F)CN1CCC(NC(=O)C(C)C)CC1.[H][H] |
| InChI | InChI=1S/C16H30F2N2O2.H2/c1-4-22-11-5-8-16(17,18)12-20-9-6-14(7-10-20)19-15(21)13(2)3;/h13-14H,4-12H2,1-3H3,(H,19,21);1H |
| InChIKey | DJXYECOGHWRUSM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|