About oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate
oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate (PubChem CID 166467561) has the molecular formula C21H30N2O6S
and a molecular weight of 438.55 g/mol. Its IUPAC name is oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
| PubChem CID | 166467561 |
| Molecular Formula | C21H30N2O6S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
| SMILES | CN(C)CCc1cn(S(=O)(=O)OCC(C)(C)C(=O)OC2CCOC2)c2ccccc12 |
| InChI | InChI=1S/C21H30N2O6S/c1-21(2,20(24)29-17-10-12-27-14-17)15-28-30(25,26)23-13-16(9-11-22(3)4)18-7-5-6-8-19(18)23/h5-8,13,17H,9-12,14-15H2,1-4H3 |
| InChIKey | DWRKHRHXFUGUFI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The IUPAC name of oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate (CID 166467561) is oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate.
What is the SMILES notation for oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The canonical SMILES for oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate is CN(C)CCc1cn(S(=O)(=O)OCC(C)(C)C(=O)OC2CCOC2)c2ccccc12.
What is the InChIKey of oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
The InChIKey is DWRKHRHXFUGUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O6S/c1-21(2,20(24)29-17-10-12-27-14-17)15-28-30(25,26)23-13-16(9-11-22(3)4)18-7-5-6-8-19(18)23/h5-8,13,17H,9-12,14-15H2,1-4H3.
What are the key properties of oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate?
oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate has a molecular weight of 438.55 g/mol, XLogP of 2.21, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 3-[3-[2-(dimethylamino)ethyl]indol-1-yl]sulfonyloxy-2,2-dimethylpropanoate is sourced from PubChem (CID 166467561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).