C33H32ClN5O2 — CID 16646772
(4-butoxyphenyl)-[4-[7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 16646772) has the molecular formula C33H32ClN5O2 and a molecular weight of 566.10 g/mol. Its IUPAC name is (4-butoxyphenyl)-[4-[7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-butoxyphenyl)-[4-[7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 16646772 |
| Molecular Formula | C33H32ClN5O2 |
| Molecular Weight | 566.10 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (4-butoxyphenyl)-[4-[7-(4-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCN(c3ncnc4c3c(-c3ccccc3)cn4-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H32ClN5O2/c1-2-3-21-41-28-15-9-25(10-16-28)33(40)38-19-17-37(18-20-38)31-30-29(24-7-5-4-6-8-24)22-39(32(30)36-23-35-31)27-13-11-26(34)12-14-27/h4-16,22-23H,2-3,17-21H2,1H3 |
| InChIKey | BXOMZKQKNOCLJF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.10 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|