About 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine
3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine (PubChem CID 166468818) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine.
Molecular Properties
| Compound Name | 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine |
| PubChem CID | 166468818 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine |
| SMILES | COC1=C(C2CNC2)CCC=C1 |
| InChI | InChI=1S/C10H15NO/c1-12-10-5-3-2-4-9(10)8-6-11-7-8/h3,5,8,11H,2,4,6-7H2,1H3 |
| InChIKey | FRERRXGYIJTIAF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine?
The IUPAC name of 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine (CID 166468818) is 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine.
What is the SMILES notation for 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine?
The canonical SMILES for 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine is COC1=C(C2CNC2)CCC=C1.
What is the InChIKey of 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine?
The InChIKey is FRERRXGYIJTIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-12-10-5-3-2-4-9(10)8-6-11-7-8/h3,5,8,11H,2,4,6-7H2,1H3.
What are the key properties of 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine?
3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine has a molecular weight of 165.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxycyclohexa-1,3-dien-1-yl)azetidine is sourced from PubChem (CID 166468818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).